C10H10N2O2 — CID 14297058
5-nitro-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (PubChem CID 14297058) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 5-nitro-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
| Compound Name | 5-nitro-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 14297058 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 5-nitro-3-azatricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
| SMILES | O=[N+]([O-])c1cnc2c(c1)C1CCC2C1 |
| InChI | InChI=1S/C10H10N2O2/c13-12(14)8-4-9-6-1-2-7(3-6)10(9)11-5-8/h4-7H,1-3H2 |
| InChIKey | WZSVDVYYDZSAOZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|