C10H12N2O2 — CID 15462861
6-methyl-3-nitro-5,6,7,8-tetrahydroquinoline (PubChem CID 15462861) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 6-methyl-3-nitro-5,6,7,8-tetrahydroquinoline.
| Compound Name | 6-methyl-3-nitro-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 15462861 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 6-methyl-3-nitro-5,6,7,8-tetrahydroquinoline |
| SMILES | CC1CCc2ncc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C10H12N2O2/c1-7-2-3-10-8(4-7)5-9(6-11-10)12(13)14/h5-7H,2-4H2,1H3 |
| InChIKey | PQLXNBHHLPQVGS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|