C19H17N3O3 — CID 14423232
7-methyl-10-(3-nitrophenyl)-6,7,8,9-tetrahydrobenzo[b][1,8]naphthyridin-5-one (PubChem CID 14423232) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is 7-methyl-10-(3-nitrophenyl)-6,7,8,9-tetrahydrobenzo[b][1,8]naphthyridin-5-one.
| Compound Name | 7-methyl-10-(3-nitrophenyl)-6,7,8,9-tetrahydrobenzo[b][1,8]naphthyridin-5-one |
|---|---|
| PubChem CID | 14423232 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 7-methyl-10-(3-nitrophenyl)-6,7,8,9-tetrahydrobenzo[b][1,8]naphthyridin-5-one |
| SMILES | CC1CCc2c(c(=O)c3cccnc3n2-c2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C19H17N3O3/c1-12-7-8-17-16(10-12)18(23)15-6-3-9-20-19(15)21(17)13-4-2-5-14(11-13)22(24)25/h2-6,9,11-12H,7-8,10H2,1H3 |
| InChIKey | SFJYDBONTXZMSH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|