C21H12Cl2N4O4 — CID 70011543
N-(2,6-dichlorophenyl)-1-(3-nitrophenyl)-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 70011543) has the molecular formula C21H12Cl2N4O4 and a molecular weight of 455.26 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-1-(3-nitrophenyl)-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-1-(3-nitrophenyl)-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 70011543 |
| Molecular Formula | C21H12Cl2N4O4 |
| Molecular Weight | 455.26 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | N-(2,6-dichlorophenyl)-1-(3-nitrophenyl)-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(Nc1c(Cl)cccc1Cl)c1cn(-c2cccc([N+](=O)[O-])c2)c2ncccc2c1=O |
| InChI | InChI=1S/C21H12Cl2N4O4/c22-16-7-2-8-17(23)18(16)25-21(29)15-11-26(12-4-1-5-13(10-12)27(30)31)20-14(19(15)28)6-3-9-24-20/h1-11H,(H,25,29) |
| InChIKey | BIKGZKMGHRRETO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.26 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|