C16H12N4O3 — CID 14423223
2-(3-nitrophenyl)-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one (PubChem CID 14423223) has the molecular formula C16H12N4O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one.
| Compound Name | 2-(3-nitrophenyl)-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one |
|---|---|
| PubChem CID | 14423223 |
| Molecular Formula | C16H12N4O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-(3-nitrophenyl)-2,10,13-triazatricyclo[7.4.0.03,7]trideca-1(13),3(7),9,11-tetraen-8-one |
| SMILES | O=c1c2c(n(-c3cccc([N+](=O)[O-])c3)c3nccnc13)CCC2 |
| InChI | InChI=1S/C16H12N4O3/c21-15-12-5-2-6-13(12)19(16-14(15)17-7-8-18-16)10-3-1-4-11(9-10)20(22)23/h1,3-4,7-9H,2,5-6H2 |
| InChIKey | SSOHIHNWJQTYDL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|