C11H14N2O3 — CID 143877101
(6R,9R)-6-methyl-3-nitro-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-9-ol (PubChem CID 143877101) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is (6R,9R)-6-methyl-3-nitro-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-9-ol.
| Compound Name | (6R,9R)-6-methyl-3-nitro-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-9-ol |
|---|---|
| PubChem CID | 143877101 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (6R,9R)-6-methyl-3-nitro-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-9-ol |
| SMILES | C[C@@H]1CC[C@@H](O)c2ncc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C11H14N2O3/c1-7-2-3-10(14)11-8(4-7)5-9(6-12-11)13(15)16/h5-7,10,14H,2-4H2,1H3/t7-,10-/m1/s1 |
| InChIKey | OUTSXJBZYRKTCI-GMSGAONNSA-N |
| XLogP | 2.00 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|