C10H11N3O5 — CID 90908740
(6-hydroxy-3-nitro-5,6,7,8-tetrahydroquinolin-7-yl) carbamate (PubChem CID 90908740) has the molecular formula C10H11N3O5 and a molecular weight of 253.21 g/mol. Its IUPAC name is (6-hydroxy-3-nitro-5,6,7,8-tetrahydroquinolin-7-yl) carbamate.
| Compound Name | (6-hydroxy-3-nitro-5,6,7,8-tetrahydroquinolin-7-yl) carbamate |
|---|---|
| PubChem CID | 90908740 |
| Molecular Formula | C10H11N3O5 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | (6-hydroxy-3-nitro-5,6,7,8-tetrahydroquinolin-7-yl) carbamate |
| SMILES | NC(=O)OC1Cc2ncc([N+](=O)[O-])cc2CC1O |
| InChI | InChI=1S/C10H11N3O5/c11-10(15)18-9-3-7-5(2-8(9)14)1-6(4-12-7)13(16)17/h1,4,8-9,14H,2-3H2,(H2,11,15) |
| InChIKey | WJMHICSVTLXTBV-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|