C22H28N4O3 — CID 97261431
2-methyl-3-[[(2R)-3-methylbutan-2-yl]amino]-N-[(6S)-3-nitro-5,6,7,8-tetrahydroquinolin-6-yl]benzamide (PubChem CID 97261431) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-methyl-3-[[(2R)-3-methylbutan-2-yl]amino]-N-[(6S)-3-nitro-5,6,7,8-tetrahydroquinolin-6-yl]benzamide.
| Compound Name | 2-methyl-3-[[(2R)-3-methylbutan-2-yl]amino]-N-[(6S)-3-nitro-5,6,7,8-tetrahydroquinolin-6-yl]benzamide |
|---|---|
| PubChem CID | 97261431 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 2-methyl-3-[[(2R)-3-methylbutan-2-yl]amino]-N-[(6S)-3-nitro-5,6,7,8-tetrahydroquinolin-6-yl]benzamide |
| SMILES | Cc1c(N[C@H](C)C(C)C)cccc1C(=O)N[C@H]1CCc2ncc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C22H28N4O3/c1-13(2)15(4)24-20-7-5-6-19(14(20)3)22(27)25-17-8-9-21-16(10-17)11-18(12-23-21)26(28)29/h5-7,11-13,15,17,24H,8-10H2,1-4H3,(H,25,27)/t15-,17+/m1/s1 |
| InChIKey | TWTKKOZLBUIZES-WBVHZDCISA-N |
| XLogP | 4.04 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|