C18H26N4O3 — CID 136521468
1-(3,5-dimethylpiperidin-1-yl)-2-(3-nitro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)propan-1-one (PubChem CID 136521468) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperidin-1-yl)-2-(3-nitro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)propan-1-one.
| Compound Name | 1-(3,5-dimethylpiperidin-1-yl)-2-(3-nitro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)propan-1-one |
|---|---|
| PubChem CID | 136521468 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-(3,5-dimethylpiperidin-1-yl)-2-(3-nitro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)propan-1-one |
| SMILES | CC1CC(C)CN(C(=O)C(C)N2CCc3ncc([N+](=O)[O-])cc3C2)C1 |
| InChI | InChI=1S/C18H26N4O3/c1-12-6-13(2)10-21(9-12)18(23)14(3)20-5-4-17-15(11-20)7-16(8-19-17)22(24)25/h7-8,12-14H,4-6,9-11H2,1-3H3 |
| InChIKey | RFORAPMMUOHZAO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|