C24H27BrN6O7 — CID 158990444
3-bromo-2-methoxy-5-nitropyridine;3-cyclopropyl-2-methoxy-5-nitropyridine;5-cyclopropyl-6-methoxypyridin-3-amine (PubChem CID 158990444) has the molecular formula C24H27BrN6O7 and a molecular weight of 591.42 g/mol. Its IUPAC name is 3-bromo-2-methoxy-5-nitropyridine;3-cyclopropyl-2-methoxy-5-nitropyridine;5-cyclopropyl-6-methoxypyridin-3-amine.
| Compound Name | 3-bromo-2-methoxy-5-nitropyridine;3-cyclopropyl-2-methoxy-5-nitropyridine;5-cyclopropyl-6-methoxypyridin-3-amine |
|---|---|
| PubChem CID | 158990444 |
| Molecular Formula | C24H27BrN6O7 |
| Molecular Weight | 591.42 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | 3-bromo-2-methoxy-5-nitropyridine;3-cyclopropyl-2-methoxy-5-nitropyridine;5-cyclopropyl-6-methoxypyridin-3-amine |
| SMILES | COc1ncc(N)cc1C1CC1.COc1ncc([N+](=O)[O-])cc1Br.COc1ncc([N+](=O)[O-])cc1C1CC1 |
| InChI | InChI=1S/C9H10N2O3.C9H12N2O.C6H5BrN2O3/c1-14-9-8(6-2-3-6)4-7(5-10-9)11(12)13;1-12-9-8(6-2-3-6)4-7(10)5-11-9;1-12-6-5(7)2-4(3-8-6)9(10)11/h4-6H,2-3H2,1H3;4-6H,2-3,10H2,1H3;2-3H,1H3 |
| InChIKey | JQCCOEJQAIIEFP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|