C9H10N4O4 — CID 22181365
N-(cyclopropylmethyl)-3,5-dinitropyridin-2-amine (PubChem CID 22181365) has the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3,5-dinitropyridin-2-amine.
| Compound Name | N-(cyclopropylmethyl)-3,5-dinitropyridin-2-amine |
|---|---|
| PubChem CID | 22181365 |
| Molecular Formula | C9H10N4O4 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | N-(cyclopropylmethyl)-3,5-dinitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cnc(NCC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H10N4O4/c14-12(15)7-3-8(13(16)17)9(11-5-7)10-4-6-1-2-6/h3,5-6H,1-2,4H2,(H,10,11) |
| InChIKey | IUYVMMQIZMENLB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|