C10H13ClN4O2 — CID 71008237
5-chloro-3-nitro-N-[[(3R)-pyrrolidin-3-yl]methyl]pyridin-2-amine (PubChem CID 71008237) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is 5-chloro-3-nitro-N-[[(3R)-pyrrolidin-3-yl]methyl]pyridin-2-amine.
| Compound Name | 5-chloro-3-nitro-N-[[(3R)-pyrrolidin-3-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 71008237 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 5-chloro-3-nitro-N-[[(3R)-pyrrolidin-3-yl]methyl]pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc(Cl)cnc1NC[C@@H]1CCNC1 |
| InChI | InChI=1S/C10H13ClN4O2/c11-8-3-9(15(16)17)10(14-6-8)13-5-7-1-2-12-4-7/h3,6-7,12H,1-2,4-5H2,(H,13,14)/t7-/m1/s1 |
| InChIKey | BYAYCMWBYLISHO-SSDOTTSWSA-N |
| XLogP | 1.66 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|