C17H10F2N2O8 — CID 156761766
trans-bis(2-fluoro-4-nitrophenyl) (1R,2R)-cyclopropane-1,2-dicarboxylate (PubChem CID 156761766) has the molecular formula C17H10F2N2O8 and a molecular weight of 408.27 g/mol. Its IUPAC name is trans-bis(2-fluoro-4-nitrophenyl) (1R,2R)-cyclopropane-1,2-dicarboxylate.
| Compound Name | trans-bis(2-fluoro-4-nitrophenyl) (1R,2R)-cyclopropane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 156761766 |
| Molecular Formula | C17H10F2N2O8 |
| Molecular Weight | 408.27 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | trans-bis(2-fluoro-4-nitrophenyl) (1R,2R)-cyclopropane-1,2-dicarboxylate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1F)[C@@H]1C[C@H]1C(=O)Oc1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C17H10F2N2O8/c18-12-5-8(20(24)25)1-3-14(12)28-16(22)10-7-11(10)17(23)29-15-4-2-9(21(26)27)6-13(15)19/h1-6,10-11H,7H2/t10-,11-/m1/s1 |
| InChIKey | FNYYDZKLSHYLBI-GHMZBOCLSA-N |
| XLogP | 2.93 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|