C11H12FNO5 — CID 104673652
3-(2-fluoro-4-nitrophenoxy)-2-methoxycyclobutan-1-ol (PubChem CID 104673652) has the molecular formula C11H12FNO5 and a molecular weight of 257.22 g/mol. Its IUPAC name is 3-(2-fluoro-4-nitrophenoxy)-2-methoxycyclobutan-1-ol.
| Compound Name | 3-(2-fluoro-4-nitrophenoxy)-2-methoxycyclobutan-1-ol |
|---|---|
| PubChem CID | 104673652 |
| Molecular Formula | C11H12FNO5 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-(2-fluoro-4-nitrophenoxy)-2-methoxycyclobutan-1-ol |
| SMILES | COC1C(O)CC1Oc1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C11H12FNO5/c1-17-11-8(14)5-10(11)18-9-3-2-6(13(15)16)4-7(9)12/h2-4,8,10-11,14H,5H2,1H3 |
| InChIKey | YTKJNENIGVFGGO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|