C13H17NO5 — CID 102732545
trans-(1S,2S)-2-(2-methoxy-5-nitrophenoxy)cyclohexan-1-ol (PubChem CID 102732545) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2-methoxy-5-nitrophenoxy)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(2-methoxy-5-nitrophenoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102732545 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | trans-(1S,2S)-2-(2-methoxy-5-nitrophenoxy)cyclohexan-1-ol |
| SMILES | COc1ccc([N+](=O)[O-])cc1O[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C13H17NO5/c1-18-12-7-6-9(14(16)17)8-13(12)19-11-5-3-2-4-10(11)15/h6-8,10-11,15H,2-5H2,1H3/t10-,11-/m0/s1 |
| InChIKey | FQSKLCHBAPXLIW-QWRGUYRKSA-N |
| XLogP | 2.29 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|