C13H18N2O4 — CID 176696572
trans-(1S,2S)-2-(2-methoxy-4-nitrophenoxy)-N,N-dimethylcyclobutan-1-amine (PubChem CID 176696572) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2-methoxy-4-nitrophenoxy)-N,N-dimethylcyclobutan-1-amine.
| Compound Name | trans-(1S,2S)-2-(2-methoxy-4-nitrophenoxy)-N,N-dimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 176696572 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | trans-(1S,2S)-2-(2-methoxy-4-nitrophenoxy)-N,N-dimethylcyclobutan-1-amine |
| SMILES | COc1cc([N+](=O)[O-])ccc1O[C@H]1CC[C@@H]1N(C)C |
| InChI | InChI=1S/C13H18N2O4/c1-14(2)10-5-7-11(10)19-12-6-4-9(15(16)17)8-13(12)18-3/h4,6,8,10-11H,5,7H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | VZXGOKRQKMRXKN-QWRGUYRKSA-N |
| XLogP | 2.07 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|