C11H10F3NO4 — CID 139548238
cis-(1S,2R)-4,4-difluoro-2-(2-fluoro-4-nitrophenoxy)cyclopentan-1-ol (PubChem CID 139548238) has the molecular formula C11H10F3NO4 and a molecular weight of 277.20 g/mol. Its IUPAC name is cis-(1S,2R)-4,4-difluoro-2-(2-fluoro-4-nitrophenoxy)cyclopentan-1-ol.
| Compound Name | cis-(1S,2R)-4,4-difluoro-2-(2-fluoro-4-nitrophenoxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 139548238 |
| Molecular Formula | C11H10F3NO4 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | cis-(1S,2R)-4,4-difluoro-2-(2-fluoro-4-nitrophenoxy)cyclopentan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(O[C@@H]2CC(F)(F)C[C@@H]2O)c(F)c1 |
| InChI | InChI=1S/C11H10F3NO4/c12-7-3-6(15(17)18)1-2-9(7)19-10-5-11(13,14)4-8(10)16/h1-3,8,10,16H,4-5H2/t8-,10+/m0/s1 |
| InChIKey | LILLOGUFXUJPOG-WCBMZHEXSA-N |
| XLogP | 2.27 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|