C14H15FN2O5 — CID 141181782
3-(2-fluoro-4-nitrophenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 141181782) has the molecular formula C14H15FN2O5 and a molecular weight of 310.28 g/mol. Its IUPAC name is 3-(2-fluoro-4-nitrophenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | 3-(2-fluoro-4-nitrophenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 141181782 |
| Molecular Formula | C14H15FN2O5 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-(2-fluoro-4-nitrophenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | O=C(O)N1C2CCC1CC(Oc1ccc([N+](=O)[O-])cc1F)C2 |
| InChI | InChI=1S/C14H15FN2O5/c15-12-7-10(17(20)21)3-4-13(12)22-11-5-8-1-2-9(6-11)16(8)14(18)19/h3-4,7-9,11H,1-2,5-6H2,(H,18,19) |
| InChIKey | VKYAHSDMZOUOOJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|