C13H16FN3O4 — CID 79646685
3-(2-fluoro-4-nitrophenoxy)-1-(methylamino)cyclopentane-1-carboxamide (PubChem CID 79646685) has the molecular formula C13H16FN3O4 and a molecular weight of 297.29 g/mol. Its IUPAC name is 3-(2-fluoro-4-nitrophenoxy)-1-(methylamino)cyclopentane-1-carboxamide.
| Compound Name | 3-(2-fluoro-4-nitrophenoxy)-1-(methylamino)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79646685 |
| Molecular Formula | C13H16FN3O4 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-(2-fluoro-4-nitrophenoxy)-1-(methylamino)cyclopentane-1-carboxamide |
| SMILES | CNC1(C(N)=O)CCC(Oc2ccc([N+](=O)[O-])cc2F)C1 |
| InChI | InChI=1S/C13H16FN3O4/c1-16-13(12(15)18)5-4-9(7-13)21-11-3-2-8(17(19)20)6-10(11)14/h2-3,6,9,16H,4-5,7H2,1H3,(H2,15,18) |
| InChIKey | VMRYCHOOPKSWIE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|