C14H10N2O7S2 — CID 2743450
[2-(1,3-dithiolan-2-yl)-4-nitrophenyl] 5-nitrofuran-2-carboxylate (PubChem CID 2743450) has the molecular formula C14H10N2O7S2 and a molecular weight of 382.38 g/mol. Its IUPAC name is [2-(1,3-dithiolan-2-yl)-4-nitrophenyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-(1,3-dithiolan-2-yl)-4-nitrophenyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 2743450 |
| Molecular Formula | C14H10N2O7S2 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | [2-(1,3-dithiolan-2-yl)-4-nitrophenyl] 5-nitrofuran-2-carboxylate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1C1SCCS1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C14H10N2O7S2/c17-13(11-3-4-12(22-11)16(20)21)23-10-2-1-8(15(18)19)7-9(10)14-24-5-6-25-14/h1-4,7,14H,5-6H2 |
| InChIKey | ONWPRAZPBUTGCQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 125.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|