C13H11NO5 — CID 47097436
(2,4-dimethylphenyl) 5-nitrofuran-2-carboxylate (PubChem CID 47097436) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 5-nitrofuran-2-carboxylate.
| Compound Name | (2,4-dimethylphenyl) 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 47097436 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (2,4-dimethylphenyl) 5-nitrofuran-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2ccc([N+](=O)[O-])o2)c(C)c1 |
| InChI | InChI=1S/C13H11NO5/c1-8-3-4-10(9(2)7-8)19-13(15)11-5-6-12(18-11)14(16)17/h3-7H,1-2H3 |
| InChIKey | HDYAWHQRQFIBLZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|