C17H17NO6 — CID 9454886
[(2R)-1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 5-nitrofuran-2-carboxylate (PubChem CID 9454886) has the molecular formula C17H17NO6 and a molecular weight of 331.32 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 5-nitrofuran-2-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 9454886 |
| Molecular Formula | C17H17NO6 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | [(2R)-1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 5-nitrofuran-2-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)[C@@H](C)OC(=O)c2ccc([N+](=O)[O-])o2)cc1C |
| InChI | InChI=1S/C17H17NO6/c1-9-7-11(3)13(8-10(9)2)16(19)12(4)23-17(20)14-5-6-15(24-14)18(21)22/h5-8,12H,1-4H3/t12-/m1/s1 |
| InChIKey | XNVAQOZCQRNFID-GFCCVEGCSA-N |
| XLogP | 3.54 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|