C11H13N3O7 — CID 2637595
[(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate (PubChem CID 2637595) has the molecular formula C11H13N3O7 and a molecular weight of 299.24 g/mol. Its IUPAC name is [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate.
| Compound Name | [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 2637595 |
| Molecular Formula | C11H13N3O7 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | [(2R)-1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
| SMILES | CCNC(=O)NC(=O)[C@@H](C)OC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C11H13N3O7/c1-3-12-11(17)13-9(15)6(2)20-10(16)7-4-5-8(21-7)14(18)19/h4-6H,3H2,1-2H3,(H2,12,13,15,17)/t6-/m1/s1 |
| InChIKey | AFNVIMDIDVWNDH-ZCFIWIBFSA-N |
| XLogP | 0.58 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|