C21H21NO7 — CID 8020855
1-O-methyl 3-O-[(2R)-1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 8020855) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is 1-O-methyl 3-O-[(2R)-1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 1-O-methyl 3-O-[(2R)-1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 8020855 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 1-O-methyl 3-O-[(2R)-1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)O[C@H](C)C(=O)c2cc(C)c(C)cc2C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H21NO7/c1-11-6-13(3)18(7-12(11)2)19(23)14(4)29-21(25)16-8-15(20(24)28-5)9-17(10-16)22(26)27/h6-10,14H,1-5H3/t14-/m1/s1 |
| InChIKey | GGBRXFRQFRMQBM-CQSZACIVSA-N |
| XLogP | 3.73 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|