C21H22N2O6 — CID 9269567
[(2S)-1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[(3-nitrobenzoyl)amino]acetate (PubChem CID 9269567) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[(3-nitrobenzoyl)amino]acetate.
| Compound Name | [(2S)-1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[(3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 9269567 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [(2S)-1-oxo-1-(2,4,5-trimethylphenyl)propan-2-yl] 2-[(3-nitrobenzoyl)amino]acetate |
| SMILES | Cc1cc(C)c(C(=O)[C@H](C)OC(=O)CNC(=O)c2cccc([N+](=O)[O-])c2)cc1C |
| InChI | InChI=1S/C21H22N2O6/c1-12-8-14(3)18(9-13(12)2)20(25)15(4)29-19(24)11-22-21(26)16-6-5-7-17(10-16)23(27)28/h5-10,15H,11H2,1-4H3,(H,22,26)/t15-/m0/s1 |
| InChIKey | CREQOQQJRAWWSP-HNNXBMFYSA-N |
| XLogP | 3.06 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|