C17H14F2N2O5 — CID 55910145
1-(2,5-difluorophenyl)ethyl 2-[(3-nitrobenzoyl)amino]acetate (PubChem CID 55910145) has the molecular formula C17H14F2N2O5 and a molecular weight of 364.30 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)ethyl 2-[(3-nitrobenzoyl)amino]acetate.
| Compound Name | 1-(2,5-difluorophenyl)ethyl 2-[(3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55910145 |
| Molecular Formula | C17H14F2N2O5 |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 1-(2,5-difluorophenyl)ethyl 2-[(3-nitrobenzoyl)amino]acetate |
| SMILES | CC(OC(=O)CNC(=O)c1cccc([N+](=O)[O-])c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C17H14F2N2O5/c1-10(14-8-12(18)5-6-15(14)19)26-16(22)9-20-17(23)11-3-2-4-13(7-11)21(24)25/h2-8,10H,9H2,1H3,(H,20,23) |
| InChIKey | XSSMAEVJZBEGES-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|