C16H16N2O8 — CID 9454944
methyl 2,4-dimethyl-5-[(2R)-2-(5-nitrofuran-2-carbonyl)oxypropanoyl]-1H-pyrrole-3-carboxylate (PubChem CID 9454944) has the molecular formula C16H16N2O8 and a molecular weight of 364.31 g/mol. Its IUPAC name is methyl 2,4-dimethyl-5-[(2R)-2-(5-nitrofuran-2-carbonyl)oxypropanoyl]-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 2,4-dimethyl-5-[(2R)-2-(5-nitrofuran-2-carbonyl)oxypropanoyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 9454944 |
| Molecular Formula | C16H16N2O8 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | methyl 2,4-dimethyl-5-[(2R)-2-(5-nitrofuran-2-carbonyl)oxypropanoyl]-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2ccc([N+](=O)[O-])o2)c1C |
| InChI | InChI=1S/C16H16N2O8/c1-7-12(16(21)24-4)8(2)17-13(7)14(19)9(3)25-15(20)10-5-6-11(26-10)18(22)23/h5-6,9,17H,1-4H3/t9-/m1/s1 |
| InChIKey | JGAIFNIZZWAOMP-SECBINFHSA-N |
| XLogP | 2.35 |
| TPSA | 141.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|