C16H16N2O7S — CID 9364382
methyl 2,4-dimethyl-5-[(2R)-2-(5-nitrothiophene-2-carbonyl)oxypropanoyl]-1H-pyrrole-3-carboxylate (PubChem CID 9364382) has the molecular formula C16H16N2O7S and a molecular weight of 380.38 g/mol. Its IUPAC name is methyl 2,4-dimethyl-5-[(2R)-2-(5-nitrothiophene-2-carbonyl)oxypropanoyl]-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 2,4-dimethyl-5-[(2R)-2-(5-nitrothiophene-2-carbonyl)oxypropanoyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 9364382 |
| Molecular Formula | C16H16N2O7S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | methyl 2,4-dimethyl-5-[(2R)-2-(5-nitrothiophene-2-carbonyl)oxypropanoyl]-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2ccc([N+](=O)[O-])s2)c1C |
| InChI | InChI=1S/C16H16N2O7S/c1-7-12(16(21)24-4)8(2)17-13(7)14(19)9(3)25-15(20)10-5-6-11(26-10)18(22)23/h5-6,9,17H,1-4H3/t9-/m1/s1 |
| InChIKey | SYXPKYWXIRJDMD-SECBINFHSA-N |
| XLogP | 2.82 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|