C16H16N2O6S — CID 8744213
[(2R)-1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] 5-nitrothiophene-2-carboxylate (PubChem CID 8744213) has the molecular formula C16H16N2O6S and a molecular weight of 364.38 g/mol. Its IUPAC name is [(2R)-1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] 5-nitrothiophene-2-carboxylate.
| Compound Name | [(2R)-1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] 5-nitrothiophene-2-carboxylate |
|---|---|
| PubChem CID | 8744213 |
| Molecular Formula | C16H16N2O6S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [(2R)-1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-1-oxopropan-2-yl] 5-nitrothiophene-2-carboxylate |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)[C@@H](C)OC(=O)c2ccc([N+](=O)[O-])s2)c1C |
| InChI | InChI=1S/C16H16N2O6S/c1-7-13(9(3)19)8(2)17-14(7)15(20)10(4)24-16(21)11-5-6-12(25-11)18(22)23/h5-6,10,17H,1-4H3/t10-/m1/s1 |
| InChIKey | FPRPDGIWFALJCC-SNVBAGLBSA-N |
| XLogP | 3.23 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|