C22H26N2O4S6 — CID 10393342
2,10-bis(4-nitrophenyl)-1,3,6,9,11,14-hexathiacyclohexadecane (PubChem CID 10393342) has the molecular formula C22H26N2O4S6 and a molecular weight of 574.86 g/mol. Its IUPAC name is 2,10-bis(4-nitrophenyl)-1,3,6,9,11,14-hexathiacyclohexadecane.
| Compound Name | 2,10-bis(4-nitrophenyl)-1,3,6,9,11,14-hexathiacyclohexadecane |
|---|---|
| PubChem CID | 10393342 |
| Molecular Formula | C22H26N2O4S6 |
| Molecular Weight | 574.86 g/mol |
| Exact Mass | 574.02 |
| IUPAC Name | 2,10-bis(4-nitrophenyl)-1,3,6,9,11,14-hexathiacyclohexadecane |
| SMILES | O=[N+]([O-])c1ccc(C2SCCSCCSC(c3ccc([N+](=O)[O-])cc3)SCCSCCS2)cc1 |
| InChI | InChI=1S/C22H26N2O4S6/c25-23(26)19-5-1-17(2-6-19)21-31-13-9-29-11-15-33-22(34-16-12-30-10-14-32-21)18-3-7-20(8-4-18)24(27)28/h1-8,21-22H,9-16H2 |
| InChIKey | DPIXRWOPNHIMGA-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.86 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|