C16H12N2O3S2 — CID 2743410
4-[4-(1,3-dithiolan-2-yl)phenoxy]-3-nitrobenzonitrile (PubChem CID 2743410) has the molecular formula C16H12N2O3S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-[4-(1,3-dithiolan-2-yl)phenoxy]-3-nitrobenzonitrile.
| Compound Name | 4-[4-(1,3-dithiolan-2-yl)phenoxy]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 2743410 |
| Molecular Formula | C16H12N2O3S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 4-[4-(1,3-dithiolan-2-yl)phenoxy]-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(C3SCCS3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12N2O3S2/c17-10-11-1-6-15(14(9-11)18(19)20)21-13-4-2-12(3-5-13)16-22-7-8-23-16/h1-6,9,16H,7-8H2 |
| InChIKey | MAMYLEOQCCQORR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|