C21H23N3O5S2 — CID 2743413
[[amino-[4-[4-(1,3-dithiolan-2-yl)phenoxy]-3-nitrophenyl]methylidene]amino] 2,2-dimethylpropanoate (PubChem CID 2743413) has the molecular formula C21H23N3O5S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is [[amino-[4-[4-(1,3-dithiolan-2-yl)phenoxy]-3-nitrophenyl]methylidene]amino] 2,2-dimethylpropanoate.
| Compound Name | [[amino-[4-[4-(1,3-dithiolan-2-yl)phenoxy]-3-nitrophenyl]methylidene]amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 2743413 |
| Molecular Formula | C21H23N3O5S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | [[amino-[4-[4-(1,3-dithiolan-2-yl)phenoxy]-3-nitrophenyl]methylidene]amino] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON=C(N)c1ccc(Oc2ccc(C3SCCS3)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23N3O5S2/c1-21(2,3)20(25)29-23-18(22)14-6-9-17(16(12-14)24(26)27)28-15-7-4-13(5-8-15)19-30-10-11-31-19/h4-9,12,19H,10-11H2,1-3H3,(H2,22,23) |
| InChIKey | GGWIMCTXVIIUMT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|