C16H12ClNO4S2 — CID 7581317
[4-(1,3-dithiolan-2-yl)phenyl] 4-chloro-3-nitrobenzoate (PubChem CID 7581317) has the molecular formula C16H12ClNO4S2 and a molecular weight of 381.86 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)phenyl] 4-chloro-3-nitrobenzoate.
| Compound Name | [4-(1,3-dithiolan-2-yl)phenyl] 4-chloro-3-nitrobenzoate |
|---|---|
| PubChem CID | 7581317 |
| Molecular Formula | C16H12ClNO4S2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)phenyl] 4-chloro-3-nitrobenzoate |
| SMILES | O=C(Oc1ccc(C2SCCS2)cc1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H12ClNO4S2/c17-13-6-3-11(9-14(13)18(20)21)15(19)22-12-4-1-10(2-5-12)16-23-7-8-24-16/h1-6,9,16H,7-8H2 |
| InChIKey | IKJQRFAXZPZFEL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|