About (4-chloro-3-nitrophenyl) carbamate
(4-chloro-3-nitrophenyl) carbamate (PubChem CID 175197742) has the molecular formula C7H5ClN2O4
and a molecular weight of 216.58 g/mol. Its IUPAC name is (4-chloro-3-nitrophenyl) carbamate.
Molecular Properties
| Compound Name | (4-chloro-3-nitrophenyl) carbamate |
| PubChem CID | 175197742 |
| Molecular Formula | C7H5ClN2O4 |
| Molecular Weight | 216.58 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | (4-chloro-3-nitrophenyl) carbamate |
| SMILES | NC(=O)Oc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5ClN2O4/c8-5-2-1-4(14-7(9)11)3-6(5)10(12)13/h1-3H,(H2,9,11) |
| InChIKey | VBMNFEZCKRLVRB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.58 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-3-nitrophenyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-3-nitrophenyl) carbamate?
The IUPAC name of (4-chloro-3-nitrophenyl) carbamate (CID 175197742) is (4-chloro-3-nitrophenyl) carbamate.
What is the SMILES notation for (4-chloro-3-nitrophenyl) carbamate?
The canonical SMILES for (4-chloro-3-nitrophenyl) carbamate is NC(=O)Oc1ccc(Cl)c([N+](=O)[O-])c1.
What is the InChIKey of (4-chloro-3-nitrophenyl) carbamate?
The InChIKey is VBMNFEZCKRLVRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O4/c8-5-2-1-4(14-7(9)11)3-6(5)10(12)13/h1-3H,(H2,9,11).
What are the key properties of (4-chloro-3-nitrophenyl) carbamate?
(4-chloro-3-nitrophenyl) carbamate has a molecular weight of 216.58 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-3-nitrophenyl) carbamate is sourced from PubChem (CID 175197742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).