C16H12ClFO2S2 — CID 2743351
[4-(1,3-dithiolan-2-yl)phenyl] 2-chloro-6-fluorobenzoate (PubChem CID 2743351) has the molecular formula C16H12ClFO2S2 and a molecular weight of 354.86 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)phenyl] 2-chloro-6-fluorobenzoate.
| Compound Name | [4-(1,3-dithiolan-2-yl)phenyl] 2-chloro-6-fluorobenzoate |
|---|---|
| PubChem CID | 2743351 |
| Molecular Formula | C16H12ClFO2S2 |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)phenyl] 2-chloro-6-fluorobenzoate |
| SMILES | O=C(Oc1ccc(C2SCCS2)cc1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C16H12ClFO2S2/c17-12-2-1-3-13(18)14(12)15(19)20-11-6-4-10(5-7-11)16-21-8-9-22-16/h1-7,16H,8-9H2 |
| InChIKey | FVGLROILJUQYKD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|