C16H12F2O2S2 — CID 18286174
[4-(1,3-dithiolan-2-yl)phenyl] 3,5-difluorobenzoate (PubChem CID 18286174) has the molecular formula C16H12F2O2S2 and a molecular weight of 338.40 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)phenyl] 3,5-difluorobenzoate.
| Compound Name | [4-(1,3-dithiolan-2-yl)phenyl] 3,5-difluorobenzoate |
|---|---|
| PubChem CID | 18286174 |
| Molecular Formula | C16H12F2O2S2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)phenyl] 3,5-difluorobenzoate |
| SMILES | O=C(Oc1ccc(C2SCCS2)cc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H12F2O2S2/c17-12-7-11(8-13(18)9-12)15(19)20-14-3-1-10(2-4-14)16-21-5-6-22-16/h1-4,7-9,16H,5-6H2 |
| InChIKey | LTBIQRIJNPTPML-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|