C18H19NO4S3 — CID 7581328
[4-(1,3-dithiolan-2-yl)phenyl] 3-(dimethylsulfamoyl)benzoate (PubChem CID 7581328) has the molecular formula C18H19NO4S3 and a molecular weight of 409.55 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)phenyl] 3-(dimethylsulfamoyl)benzoate.
| Compound Name | [4-(1,3-dithiolan-2-yl)phenyl] 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7581328 |
| Molecular Formula | C18H19NO4S3 |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)phenyl] 3-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)Oc2ccc(C3SCCS3)cc2)c1 |
| InChI | InChI=1S/C18H19NO4S3/c1-19(2)26(21,22)16-5-3-4-14(12-16)17(20)23-15-8-6-13(7-9-15)18-24-10-11-25-18/h3-9,12,18H,10-11H2,1-2H3 |
| InChIKey | RJMLVRCJEHPVKD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|