C13H15NO6S — CID 8763209
[(3S)-2-oxooxolan-3-yl] 3-(dimethylsulfamoyl)benzoate (PubChem CID 8763209) has the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] 3-(dimethylsulfamoyl)benzoate.
| Compound Name | [(3S)-2-oxooxolan-3-yl] 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8763209 |
| Molecular Formula | C13H15NO6S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] 3-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)O[C@H]2CCOC2=O)c1 |
| InChI | InChI=1S/C13H15NO6S/c1-14(2)21(17,18)10-5-3-4-9(8-10)12(15)20-11-6-7-19-13(11)16/h3-5,8,11H,6-7H2,1-2H3/t11-/m0/s1 |
| InChIKey | UYHAAMVUZMTHQC-NSHDSACASA-N |
| XLogP | 0.41 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |