C22H23FN2O6S — CID 42915262
[1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 3-(dimethylsulfamoyl)benzoate (PubChem CID 42915262) has the molecular formula C22H23FN2O6S and a molecular weight of 462.50 g/mol. Its IUPAC name is [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 3-(dimethylsulfamoyl)benzoate.
| Compound Name | [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42915262 |
| Molecular Formula | C22H23FN2O6S |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [1-(4-fluorobenzoyl)-2-oxoazepan-3-yl] 3-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)OC2CCCCN(C(=O)c3ccc(F)cc3)C2=O)c1 |
| InChI | InChI=1S/C22H23FN2O6S/c1-24(2)32(29,30)18-7-5-6-16(14-18)22(28)31-19-8-3-4-13-25(21(19)27)20(26)15-9-11-17(23)12-10-15/h5-7,9-12,14,19H,3-4,8,13H2,1-2H3 |
| InChIKey | GEESLQYBBOOYKC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|