C23H26FN3O4S — CID 2091886
(3S)-3-[4-(benzenesulfonyl)piperazin-1-yl]-1-(4-fluorobenzoyl)azepan-2-one (PubChem CID 2091886) has the molecular formula C23H26FN3O4S and a molecular weight of 459.54 g/mol. Its IUPAC name is (3S)-3-[4-(benzenesulfonyl)piperazin-1-yl]-1-(4-fluorobenzoyl)azepan-2-one.
| Compound Name | (3S)-3-[4-(benzenesulfonyl)piperazin-1-yl]-1-(4-fluorobenzoyl)azepan-2-one |
|---|---|
| PubChem CID | 2091886 |
| Molecular Formula | C23H26FN3O4S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | (3S)-3-[4-(benzenesulfonyl)piperazin-1-yl]-1-(4-fluorobenzoyl)azepan-2-one |
| SMILES | O=C(c1ccc(F)cc1)N1CCCC[C@H](N2CCN(S(=O)(=O)c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C23H26FN3O4S/c24-19-11-9-18(10-12-19)22(28)27-13-5-4-8-21(23(27)29)25-14-16-26(17-15-25)32(30,31)20-6-2-1-3-7-20/h1-3,6-7,9-12,21H,4-5,8,13-17H2/t21-/m0/s1 |
| InChIKey | ZHSRHFXZDRXVKT-NRFANRHFSA-N |
| XLogP | 2.35 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|