C19H18FNO2S — CID 727706
(3S)-1-(4-fluorobenzoyl)-3-phenylsulfanylazepan-2-one (PubChem CID 727706) has the molecular formula C19H18FNO2S and a molecular weight of 343.42 g/mol. Its IUPAC name is (3S)-1-(4-fluorobenzoyl)-3-phenylsulfanylazepan-2-one.
| Compound Name | (3S)-1-(4-fluorobenzoyl)-3-phenylsulfanylazepan-2-one |
|---|---|
| PubChem CID | 727706 |
| Molecular Formula | C19H18FNO2S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (3S)-1-(4-fluorobenzoyl)-3-phenylsulfanylazepan-2-one |
| SMILES | O=C(c1ccc(F)cc1)N1CCCC[C@H](Sc2ccccc2)C1=O |
| InChI | InChI=1S/C19H18FNO2S/c20-15-11-9-14(10-12-15)18(22)21-13-5-4-8-17(19(21)23)24-16-6-2-1-3-7-16/h1-3,6-7,9-12,17H,4-5,8,13H2/t17-/m0/s1 |
| InChIKey | GCFQIFPBARLFHR-KRWDZBQOSA-N |
| XLogP | 4.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|