C19H17FN4O3S — CID 135928312
(3R)-1-(4-fluorobenzoyl)-3-[[5-(1H-pyrrol-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one (PubChem CID 135928312) has the molecular formula C19H17FN4O3S and a molecular weight of 400.44 g/mol. Its IUPAC name is (3R)-1-(4-fluorobenzoyl)-3-[[5-(1H-pyrrol-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one.
| Compound Name | (3R)-1-(4-fluorobenzoyl)-3-[[5-(1H-pyrrol-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one |
|---|---|
| PubChem CID | 135928312 |
| Molecular Formula | C19H17FN4O3S |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | (3R)-1-(4-fluorobenzoyl)-3-[[5-(1H-pyrrol-2-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one |
| SMILES | O=C(c1ccc(F)cc1)N1CCCC[C@@H](Sc2nnc(-c3ccc[nH]3)o2)C1=O |
| InChI | InChI=1S/C19H17FN4O3S/c20-13-8-6-12(7-9-13)17(25)24-11-2-1-5-15(18(24)26)28-19-23-22-16(27-19)14-4-3-10-21-14/h3-4,6-10,15,21H,1-2,5,11H2/t15-/m1/s1 |
| InChIKey | ANNLEIQMMGOQEK-OAHLLOKOSA-N |
| XLogP | 3.52 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|