C25H27ClN4O3S — CID 24650046
1-(4-chlorobenzoyl)-3-[[5-[4-(diethylamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one (PubChem CID 24650046) has the molecular formula C25H27ClN4O3S and a molecular weight of 499.04 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-3-[[5-[4-(diethylamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one.
| Compound Name | 1-(4-chlorobenzoyl)-3-[[5-[4-(diethylamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one |
|---|---|
| PubChem CID | 24650046 |
| Molecular Formula | C25H27ClN4O3S |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 1-(4-chlorobenzoyl)-3-[[5-[4-(diethylamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one |
| SMILES | CCN(CC)c1ccc(-c2nnc(SC3CCCCN(C(=O)c4ccc(Cl)cc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C25H27ClN4O3S/c1-3-29(4-2)20-14-10-17(11-15-20)22-27-28-25(33-22)34-21-7-5-6-16-30(24(21)32)23(31)18-8-12-19(26)13-9-18/h8-15,21H,3-7,16H2,1-2H3 |
| InChIKey | OBVVWDWOOXAFLW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|