C23H23ClN4O2S — CID 41217398
(3R)-1-(4-chlorobenzoyl)-3-[[5-methyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]azepan-2-one (PubChem CID 41217398) has the molecular formula C23H23ClN4O2S and a molecular weight of 454.98 g/mol. Its IUPAC name is (3R)-1-(4-chlorobenzoyl)-3-[[5-methyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]azepan-2-one.
| Compound Name | (3R)-1-(4-chlorobenzoyl)-3-[[5-methyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]azepan-2-one |
|---|---|
| PubChem CID | 41217398 |
| Molecular Formula | C23H23ClN4O2S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (3R)-1-(4-chlorobenzoyl)-3-[[5-methyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]azepan-2-one |
| SMILES | Cc1ccc(-n2c(C)nnc2S[C@@H]2CCCCN(C(=O)c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H23ClN4O2S/c1-15-6-12-19(13-7-15)28-16(2)25-26-23(28)31-20-5-3-4-14-27(22(20)30)21(29)17-8-10-18(24)11-9-17/h6-13,20H,3-5,14H2,1-2H3/t20-/m1/s1 |
| InChIKey | SALKNENEAWXIGC-HXUWFJFHSA-N |
| XLogP | 4.85 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|