C23H22ClN3O5S — CID 41146670
(3R)-1-(4-chlorobenzoyl)-3-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one (PubChem CID 41146670) has the molecular formula C23H22ClN3O5S and a molecular weight of 487.97 g/mol. Its IUPAC name is (3R)-1-(4-chlorobenzoyl)-3-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one.
| Compound Name | (3R)-1-(4-chlorobenzoyl)-3-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one |
|---|---|
| PubChem CID | 41146670 |
| Molecular Formula | C23H22ClN3O5S |
| Molecular Weight | 487.97 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | (3R)-1-(4-chlorobenzoyl)-3-[[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]azepan-2-one |
| SMILES | COc1ccc(-c2nnc(S[C@@H]3CCCCN(C(=O)c4ccc(Cl)cc4)C3=O)o2)cc1OC |
| InChI | InChI=1S/C23H22ClN3O5S/c1-30-17-11-8-15(13-18(17)31-2)20-25-26-23(32-20)33-19-5-3-4-12-27(22(19)29)21(28)14-6-9-16(24)10-7-14/h6-11,13,19H,3-5,12H2,1-2H3/t19-/m1/s1 |
| InChIKey | KIQPLVQNDCGYGG-LJQANCHMSA-N |
| XLogP | 4.72 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.97 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|