C21H20ClN5O3S — CID 16536101
1-(4-chlorobenzoyl)-3-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylazepan-2-one (PubChem CID 16536101) has the molecular formula C21H20ClN5O3S and a molecular weight of 457.94 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-3-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylazepan-2-one.
| Compound Name | 1-(4-chlorobenzoyl)-3-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylazepan-2-one |
|---|---|
| PubChem CID | 16536101 |
| Molecular Formula | C21H20ClN5O3S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 1-(4-chlorobenzoyl)-3-[1-(2-methoxyphenyl)tetrazol-5-yl]sulfanylazepan-2-one |
| SMILES | COc1ccccc1-n1nnnc1SC1CCCCN(C(=O)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C21H20ClN5O3S/c1-30-17-7-3-2-6-16(17)27-21(23-24-25-27)31-18-8-4-5-13-26(20(18)29)19(28)14-9-11-15(22)12-10-14/h2-3,6-7,9-12,18H,4-5,8,13H2,1H3 |
| InChIKey | PQKZJAGYQRQEAF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|