C15H14ClN3O2S2 — CID 9267815
(3R)-1-(4-chlorobenzoyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)azepan-2-one (PubChem CID 9267815) has the molecular formula C15H14ClN3O2S2 and a molecular weight of 367.88 g/mol. Its IUPAC name is (3R)-1-(4-chlorobenzoyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)azepan-2-one.
| Compound Name | (3R)-1-(4-chlorobenzoyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)azepan-2-one |
|---|---|
| PubChem CID | 9267815 |
| Molecular Formula | C15H14ClN3O2S2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | (3R)-1-(4-chlorobenzoyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)azepan-2-one |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCCC[C@@H](Sc2nncs2)C1=O |
| InChI | InChI=1S/C15H14ClN3O2S2/c16-11-6-4-10(5-7-11)13(20)19-8-2-1-3-12(14(19)21)23-15-18-17-9-22-15/h4-7,9,12H,1-3,8H2/t12-/m1/s1 |
| InChIKey | JMLCYJRILZZSQZ-GFCCVEGCSA-N |
| XLogP | 3.51 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|