C19H16F3NO2S — CID 71901949
3-(2,5-difluorophenyl)sulfanyl-1-(4-fluorobenzoyl)azepan-2-one (PubChem CID 71901949) has the molecular formula C19H16F3NO2S and a molecular weight of 379.40 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)sulfanyl-1-(4-fluorobenzoyl)azepan-2-one.
| Compound Name | 3-(2,5-difluorophenyl)sulfanyl-1-(4-fluorobenzoyl)azepan-2-one |
|---|---|
| PubChem CID | 71901949 |
| Molecular Formula | C19H16F3NO2S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 3-(2,5-difluorophenyl)sulfanyl-1-(4-fluorobenzoyl)azepan-2-one |
| SMILES | O=C(c1ccc(F)cc1)N1CCCCC(Sc2cc(F)ccc2F)C1=O |
| InChI | InChI=1S/C19H16F3NO2S/c20-13-6-4-12(5-7-13)18(24)23-10-2-1-3-16(19(23)25)26-17-11-14(21)8-9-15(17)22/h4-9,11,16H,1-3,10H2 |
| InChIKey | LALKSHJWFCJXHO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|