C20H17FN2O2S2 — CID 2535034
(3S)-3-(1,3-benzothiazol-2-ylsulfanyl)-1-(4-fluorobenzoyl)azepan-2-one (PubChem CID 2535034) has the molecular formula C20H17FN2O2S2 and a molecular weight of 400.50 g/mol. Its IUPAC name is (3S)-3-(1,3-benzothiazol-2-ylsulfanyl)-1-(4-fluorobenzoyl)azepan-2-one.
| Compound Name | (3S)-3-(1,3-benzothiazol-2-ylsulfanyl)-1-(4-fluorobenzoyl)azepan-2-one |
|---|---|
| PubChem CID | 2535034 |
| Molecular Formula | C20H17FN2O2S2 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | (3S)-3-(1,3-benzothiazol-2-ylsulfanyl)-1-(4-fluorobenzoyl)azepan-2-one |
| SMILES | O=C(c1ccc(F)cc1)N1CCCC[C@H](Sc2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C20H17FN2O2S2/c21-14-10-8-13(9-11-14)18(24)23-12-4-3-7-17(19(23)25)27-20-22-15-5-1-2-6-16(15)26-20/h1-2,5-6,8-11,17H,3-4,7,12H2/t17-/m0/s1 |
| InChIKey | ANAIHIOVNGBOIV-KRWDZBQOSA-N |
| XLogP | 4.75 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|