C21H21FN4O2S2 — CID 4786202
3-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-fluorobenzoyl)azepan-2-one (PubChem CID 4786202) has the molecular formula C21H21FN4O2S2 and a molecular weight of 444.56 g/mol. Its IUPAC name is 3-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-fluorobenzoyl)azepan-2-one.
| Compound Name | 3-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-fluorobenzoyl)azepan-2-one |
|---|---|
| PubChem CID | 4786202 |
| Molecular Formula | C21H21FN4O2S2 |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 3-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-fluorobenzoyl)azepan-2-one |
| SMILES | CCn1c(SC2CCCCN(C(=O)c3ccc(F)cc3)C2=O)nnc1-c1cccs1 |
| InChI | InChI=1S/C21H21FN4O2S2/c1-2-25-18(16-7-5-13-29-16)23-24-21(25)30-17-6-3-4-12-26(20(17)28)19(27)14-8-10-15(22)11-9-14/h5,7-11,13,17H,2-4,6,12H2,1H3 |
| InChIKey | NADSGOCRKXIUNZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|